Product Name:5,5'-Dimethyl-2,2'-bithiophene

IUPAC Name:5,5'-dimethyl-2,2'-bithiophene

CAS:16303-58-5
Molecular Formula:C10H10S2
Purity:95%+
Catalog Number:CM372568
Molecular Weight:194.31

Packing Unit Available Stock Price($) Quantity

For R&D use only.

Inquiry Form

   refresh    

Product Details

CAS NO:16303-58-5
Molecular Formula:C10H10S2
Melting Point:-
Smiles Code:CC1=CC=C(S1)C1=CC=C(C)S1
Density:
Catalog Number:CM372568
Molecular Weight:194.31
Boiling Point:
MDL No:
Storage:

Category Infos

Thiophenes
Thiophene is a five-membered heterocyclic compound containing a sulfur heteroatom with the molecular formula C4H4S. Thiophene is aromatic and is very similar to benzene; electrophilic substitution reaction is easier than benzene, and it is mainly substituted at the 2-position. Thiophene ring system has certain stability to oxidant.
Hydrogen Storage Materials
Hydrogen storage materials are materials which can store and release hydrogen gas. These materials are important for the development of hydrogen fuel cell technology, as they allow for the safe and efficient storage of hydrogen. There are several types of hydrogen storage materials, including: 1. Sorbent Materials. Carbon-based materials such as nanotubes, fullerenes, graphene, mesoporous silica, metal-organic frameworks (MOFs), isoreticular metal-organic frameworks (IRMOFs), covalent-organic frameworks (COFs), and clathrates belong to this category. 2. Complex Hydrides. These consist of light metal hydrides and chemical hydrides. 3. Nanostructured materials. These are composed of functionalized sorbent materials as well as nanoparticles of complex hydrides. The development of efficient and cost-effective hydrogen storage materials is crucial for the widespread adoption of hydrogen fuel cell technology.